Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BI-3802 is a highly potent BCL6 degrader, inhibiting the BTB domain of BCL6, with an IC50 of ??3 nM; BI-3802 has antitumor activity. |
|---|
| Catalog Num | A19733 |
|---|---|
| Formula | C24H29ClN6O3 |
| Molecular Weight | 484.98 |
| CAS Number | 2166387-65-9 |
| SMILES | ClC1=CN=C(N2C[C@H](C)C[C@H](C)C2)N=C1NC3=CC(C=C(OCC(NC)=O)C(N4C)=O)=C4C=C3 |
| Synonyms | U52; U-52; U 52; BI-3802; BI 3802; BI3802 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 3 mg/mL (6.18 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.62 mL | 103.1 mL | 206.19 mL |
| 0.5 mM | 4.12 mL | 20.62 mL | 41.24 mL |
| 1 mM | 2.06 mL | 10.31 mL | 20.62 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
