Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Bleomycin sulfate is a mixture of the sulfate salts of basic glycopeptide antineoplastic antibiotics isolated from Streptomyces verticillus. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10152 |
|---|---|
| Formula | C55H84N17O21S3.XHSO4 |
| Molecular Weight | 1415.6 |
| CAS Number | 9041-93-4 |
| SMILES | NC(C[C@H](NC[C@H](N)C(N)=O)C1=NC(N)=C(C)C(C(N[C@H](C(N[C@@H]([C@H]([C@H](C)C(N[C@@H]([C@@H](C)O)C(NCCC2=NC(C3=NC(C(NCCC[S+](C)C)=O)=CS3)=CS2)=O)=O)O)C)=O)C(O[C@@H]4O[C@@H](CO)[C@@H](O)[C@H](O)[C@@H]4O[C@@H]5[C@@H](O)[C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O5)C6=CNC=N6)=O)=N1)=O.O=S(O)([O-])=O |
| Synonyms | Blenoxane |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 93 mg/mL (61.48 mM) | |
| Water | 93 mg/mL (61.48 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 7.06 mL | 35.32 mL | 70.64 mL |
| 0.5 mM | 1.41 mL | 7.06 mL | 14.13 mL |
| 1 mM | 0.71 mL | 3.53 mL | 7.06 mL |
| 5 mM | 0.14 mL | 0.71 mL | 1.41 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
