Loading distributor info...
| Description | Dolutegravir sodium is a HIV integrase inhibitor(IC50= 2.7 nM), modest activity against raltegravir-resistant signature mutants Y143R, Q148K, N155H, and G140S/Q148H. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A16162 |
|---|---|
| Formula | C20H18F2N3NaO5 |
| Molecular Weight | 441.36 |
| CAS Number | 1051375-19-9 |
| SMILES | CC1CCOC2N1C(=O)C3=C(C(=O)C(=CN3C2)C(=O)NCC4=C(C=C(C=C4)F)F)[O-].[Na+] |
| Synonyms | DTG, GSK1349572 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 0.18 mg/mL (0.41 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.66 mL | 113.29 mL | 226.57 mL |
| 0.5 mM | 4.53 mL | 22.66 mL | 45.31 mL |
| 1 mM | 2.27 mL | 11.33 mL | 22.66 mL |
| 5 mM | 0.45 mL | 2.27 mL | 4.53 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
