Signaling Pathway
Emodin is a purgative resin, from rhubarb, the buckthorn and Japanese Knotweed (Fallopia japonica). It belongs to a family of compounds called anthraquinones, which have shown anti-inflammatory and anticancer effects
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Emodin is a purgative resin, from rhubarb, the buckthorn and Japanese Knotweed (Fallopia japonica). It belongs to a family of compounds called anthraquinones, which have shown anti-inflammatory and anticancer effects |
||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10348 |
|---|---|
| Formula | C15H10O5 |
| Molecular Weight | 270.2 |
| CAS Number | 518-82-1 |
| SMILES | CC1=CC(=C2C(=C1)C(=O)C3=CC(=CC(=C3C2=O)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 46 mg/mL (170.22 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (7.4 mM) | ||
| In vivo | 8% DMSO+75% PEG 300+8% Tween 80+ddH2O | 11 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.01 mL | 185.05 mL | 370.1 mL |
| 0.5 mM | 7.4 mL | 37.01 mL | 74.02 mL |
| 1 mM | 3.7 mL | 18.5 mL | 37.01 mL |
| 5 mM | 0.74 mL | 3.7 mL | 7.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
