Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Flufenamic acid is a nonsteroidal anti-inflammatory drug (NSAID). Inhibits calcium-activated chloride channels (CaCCs). Also increases currents through TRPC6 channels and inhibits currents through TRPC3 and TRPC7 channels. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13333 |
|---|---|
| Formula | C14H10F3NO2 |
| Molecular Weight | 281.23 |
| CAS Number | 530-78-9 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=CC=CC(=C2)C(F)(F)F |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (170.67 mM) | |
| Water | Insoluble | ||
| Ethanol | 48 mg/mL (170.67 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.56 mL | 177.79 mL | 355.58 mL |
| 0.5 mM | 7.11 mL | 35.56 mL | 71.12 mL |
| 1 mM | 3.56 mL | 17.78 mL | 35.56 mL |
| 5 mM | 0.71 mL | 3.56 mL | 7.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
