Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK3179106 is a potent and selective RET kinase inhibitor with an IC50 of 0.4 nM. |
|---|
| Catalog Num | A20434 |
|---|---|
| Formula | C22H21F4N3O4 |
| Molecular Weight | 467.41 |
| CAS Number | 1627856-64-7 |
| SMILES | O=C(NC1=NOC(C(C)(C)C(F)(F)F)=C1)CC2=CC=C(C(C(OCC)=C3)=CNC3=O)C=C2F |
| Synonyms | GSK 3179106, GSK-3179106 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (196.82 mM) | |
| Water | Insoluble | ||
| Ethanol | 6 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.39 mL | 106.97 mL | 213.94 mL |
| 0.5 mM | 4.28 mL | 21.39 mL | 42.79 mL |
| 1 mM | 2.14 mL | 10.7 mL | 21.39 mL |
| 5 mM | 0.43 mL | 2.14 mL | 4.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
