Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nicotinamide N-oxide, an in vivo nicotinamide metabolite, is a potent, and selective antagonist of the CXCR2 receptor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20532 |
|---|---|
| Formula | C6H6N2O2 |
| Molecular Weight | 138.12 |
| CAS Number | 1986-81-8 |
| SMILES | O=C(C1=C[N+]([O-])=CC=C1)N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 8 mg/mL (57.92 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 72.4 mL | 362 mL | 724.01 mL |
| 0.5 mM | 14.48 mL | 72.4 mL | 144.8 mL |
| 1 mM | 7.24 mL | 36.2 mL | 72.4 mL |
| 5 mM | 1.45 mL | 7.24 mL | 14.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
