Loading distributor info...
| Description | Nonivamide is a capsaicin analogue that exhibits anti-inflammatory properties in peripheral blood mononuclear cells and U-937 macrophages. Nonivamide is a agonist, which exhibits 4d-EC50 value of 5.1 mg/L in static toxicity tests. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A17322 |
|---|---|
| Formula | C17H25NO4 |
| Molecular Weight | 307.39 |
| CAS Number | 2444-46-4 |
| SMILES | O=C(NC(CCCCCCCC)=O)C1=CC=C(O)C(OC)=C1 |
| Synonyms | Nonivamide |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (190.86 mM) | |
| Water | Insoluble | ||
| Ethanol | 56 mg/mL (190.86 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.53 mL | 162.66 mL | 325.32 mL |
| 0.5 mM | 6.51 mL | 32.53 mL | 65.06 mL |
| 1 mM | 3.25 mL | 16.27 mL | 32.53 mL |
| 5 mM | 0.65 mL | 3.25 mL | 6.51 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
