Loading distributor info...
| Description | PD146176 (NSC168807) is a 15-Lipoxygenase (15-LO) inhibitor, which inhibits rabbit reticulocyte 15-LO with a Ki of 197 nM. PD146176 (NSC168807) has a dramatic effect in reducing atherogenesis. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A13347 |
|---|---|
| Formula | C15H11NS |
| Molecular Weight | 237.32 |
| CAS Number | 4079-26-9 |
| SMILES | C1(N2)=C(CSC3=CC=CC=C31)C4=C2C=CC=C4 |
| Synonyms | PD 146176, PD-146176, NSC 168807, NSC-168807 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 40 mg/mL (168.54 mM) | |
| Water | Insoluble | ||
| Ethanol | 17 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.14 mL | 210.69 mL | 421.37 mL |
| 0.5 mM | 8.43 mL | 42.14 mL | 84.27 mL |
| 1 mM | 4.21 mL | 21.07 mL | 42.14 mL |
| 5 mM | 0.84 mL | 4.21 mL | 8.43 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
