Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tubastatin A is a potent and selective HDAC6 inhibitor with IC50 of 15 nM in a cell-free assay, and is selective (1000-fold more) against all other isozymes except HDAC8 (57-fold more). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16770 |
|---|---|
| Formula | C20H21N3O2 |
| Molecular Weight | 335.4 |
| CAS Number | 1252003-15-8 |
| SMILES | O=C(NO)C1=CC=C(CN2C3=C(CN(C)CC3)C4=C2C=CC=C4)C=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 63 mg/mL (187.83 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 300+ddH2O | 2.3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.82 mL | 149.08 mL | 298.15 mL |
| 0.5 mM | 5.96 mL | 29.82 mL | 59.63 mL |
| 1 mM | 2.98 mL | 14.91 mL | 29.82 mL |
| 5 mM | 0.6 mL | 2.98 mL | 5.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
