Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ellagic acid is a natural phenol antioxidant found in numerous fruits and vegetables. The antiproliferative and antioxidant properties of ellagic acid have spurred preliminary research into the potential health benefits of ellagic acid consumption. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10344 |
|---|---|
| Formula | C14H6O8 |
| Molecular Weight | 302.2 |
| CAS Number | 476-66-4 |
| SMILES | C1=C2C3=C(C(=C1O)O)OC(=O)C4=CC(=C(C(=C43)OC2=O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 3 mg/mL (9.92 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.09 mL | 165.45 mL | 330.91 mL |
| 0.5 mM | 6.62 mL | 33.09 mL | 66.18 mL |
| 1 mM | 3.31 mL | 16.55 mL | 33.09 mL |
| 5 mM | 0.66 mL | 3.31 mL | 6.62 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
