Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GS-441524 could strongly inhibits feline infectious peritonitis virus (FIPV), with an EC50 of 0.78 μM. |
|---|
| Catalog Num | A22045 |
|---|---|
| Formula | C12H13N5O4 |
| Molecular Weight | 291.26 |
| CAS Number | 1191237-69-0 |
| SMILES | N#C[C@@]1(C2=CC=C3N2N=CN=C3N)O[C@H](CO)[C@@H](O)[C@H]1O |
| Synonyms | GS441524, GS 441524 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 57 mg/mL (195.7 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.33 mL | 171.67 mL | 343.34 mL |
| 0.5 mM | 6.87 mL | 34.33 mL | 68.67 mL |
| 1 mM | 3.43 mL | 17.17 mL | 34.33 mL |
| 5 mM | 0.69 mL | 3.43 mL | 6.87 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
