Loading distributor info...
| Description | Mavacamten is a modulator of cardiac myosin, with IC50s of 490, 711 nM for bovine cardiac and human cardiac, respectively. |
|---|
| Catalog Num | A19326 |
|---|---|
| Formula | C15H19N3O2 |
| Molecular Weight | 273.33 |
| CAS Number | 1642288-47-8 |
| SMILES | CC(N(C1=O)C(C=C(N[C@H](C2=CC=CC=C2)C)N1)=O)C |
| Synonyms | MYK461, MYK 461, MYK-461; SAR439152, SAR 439152, SAR-439152 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (182.93 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (18.29 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.59 mL | 182.93 mL | 365.86 mL |
| 0.5 mM | 7.32 mL | 36.59 mL | 73.17 mL |
| 1 mM | 3.66 mL | 18.29 mL | 36.59 mL |
| 5 mM | 0.73 mL | 3.66 mL | 7.32 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
