Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | STO-609 is a selective and cell-permeable inhibitor of the Ca2+/calmodulin-dependent protein kinase kinase (CaM-KK), with Ki values of 80 and 15 ng/mL for recombinant CaM-KKα and CaM-KKβ, respectively. |
|---|
| Catalog Num | A20760 |
|---|---|
| Formula | C19H10N2O3 |
| Molecular Weight | 314.29 |
| CAS Number | 52029-86-4 |
| SMILES | O=C(C1=C2C3=C(C4=NC5=CC=CC=C5N4C(C3=CC=C2)=O)C=C1)O |
| Synonyms | STO609, STO 609 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (22.27 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.82 mL | 159.09 mL | 318.18 mL |
| 0.5 mM | 6.36 mL | 31.82 mL | 63.64 mL |
| 1 mM | 3.18 mL | 15.91 mL | 31.82 mL |
| 5 mM | 0.64 mL | 3.18 mL | 6.36 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
