Loading distributor info...
| Description | SU-5402 is a potent and selective vascular endothelial growth factor receptor (VEGFR) and fibroblast growth factor receptor (FGFR) inhibitor (IC50 values are 0.02, 0.03, 0.51 and > 100 μM at VEGFR2, FGFR1, PDGFRβ and EGFR respectively). | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A11558 |
|---|---|
| Formula | C17H16N2O3 |
| Molecular Weight | 296.32 |
| CAS Number | 215543-92-3 |
| SMILES | CC1=CNC(=C1CCC(=O)O)/C=C\2/C3=CC=CC=C3NC2=O |
| Synonyms | SU5402, SU 5402 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (182.23 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.75 mL | 168.74 mL | 337.47 mL |
| 0.5 mM | 6.75 mL | 33.75 mL | 67.49 mL |
| 1 mM | 3.37 mL | 16.87 mL | 33.75 mL |
| 5 mM | 0.67 mL | 3.37 mL | 6.75 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
