Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | P005091 is a selective inhibitor of ubiquitin-specific protease (USP) 7 (IC50 = 4.2 uM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13277 |
|---|---|
| Formula | C12H7Cl2NO3S2 |
| Molecular Weight | 348.22 |
| CAS Number | 882257-11-6 |
| SMILES | CC(=O)C1=CC(=C(S1)SC2=C(C(=CC=C2)Cl)Cl)[N+](=O)[O-] |
| Synonyms | P5091 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 28 mg/mL (80.4 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 400+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.72 mL | 143.59 mL | 287.17 mL |
| 0.5 mM | 5.74 mL | 28.72 mL | 57.43 mL |
| 1 mM | 2.87 mL | 14.36 mL | 28.72 mL |
| 5 mM | 0.57 mL | 2.87 mL | 5.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
