Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | 17-AAG is an ansamycin antibiotic which acts as an anti-tumor agent. Specifically, 17-AAG binds and inhibits Hsp90. | ||
|---|---|---|---|
| Targets |
|
||
| In Vitro | Hsp90 derived from tumor cells exhibits a significantly higher binding affinity—approximately 100-fold greater—for Tanespimycin compared to Hsp90 from normal cells. In vitro reconstitution of chaperone complexes with Hsp90 demonstrated an enhanced binding affinity for Tanespimycin, accompanied by an increase in ATPase activity [1]. Tanespimycin induces the degradation of HER2, Akt, and both mutant and wild-type androgen receptor (AR), leading to retinoblastoma-dependent G1 cell cycle arrest in prostate cancer cells [2]. Furthermore, the combination of Tanespimycin and Trastuzumab in ErbB2-overexpressing breast cancer cell lines results in synergistic effects, including enhanced ubiquitination, downregulation of ErbB2 from the cell surface, and subsequent lysosomal degradation [3]. |
||
| References |
|
| Catalog Num | A10010 |
|---|---|
| Formula | C31H43N3O8 |
| Molecular Weight | 585.7 |
| CAS Number | 75747-14-7 |
| SMILES | CC1CC(C(C(C=C(C(C(C=CC=C(C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCC=C)C)OC)OC(=O)N)C)C)O)OC |
| Synonyms | Tanespimycin, NSC330507, CP 127374 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 97 mg/mL (165.61 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL | ||
| In vivo | 5%DMSO+corn oil | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.07 mL | 85.37 mL | 170.74 mL |
| 0.5 mM | 3.41 mL | 17.07 mL | 34.15 mL |
| 1 mM | 1.71 mL | 8.54 mL | 17.07 mL |
| 5 mM | 0.34 mL | 1.71 mL | 3.41 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
