Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AGI-6780 is a potent, selective inhibitor of mutant IDH2 with an IC50 value of 23 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12903 |
|---|---|
| Formula | C21H18F3N3O3S |
| Molecular Weight | 481.5 |
| CAS Number | 1432660-47-3 |
| SMILES | C1CC1NS(=O)(=O)C2=CC(=C(C=C2)C3=CSC=C3)NC(=O)NC4=CC=CC(=C4)C(F)(F)F |
| Synonyms | AGI6780 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (180.68 mM) | |
| Water | Insoluble | ||
| Ethanol | 87 mg/mL (180.68 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.77 mL | 103.84 mL | 207.68 mL |
| 0.5 mM | 4.15 mL | 20.77 mL | 41.54 mL |
| 1 mM | 2.08 mL | 10.38 mL | 20.77 mL |
| 5 mM | 0.42 mL | 2.08 mL | 4.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
