Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Anisomycin is a pyrrolidine antibiotic, acts as an anti-fungal antibiotic which inhibits Protein Synthesis, also is a potent activator of SAPKs/JNKs. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11271 |
|---|---|
| Formula | C14H19NO4 |
| Molecular Weight | 265.31 |
| CAS Number | 22862-76-6 |
| SMILES | O[C@@H]1[C@H]([C@@H](CC(C=C2)=CC=C2OC)NC1)OC(C)=O |
| Synonyms | Flagecidin, Wuningmeisu C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 35 mg/mL (131.92 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 14 mg/mL (52.76 mM) | ||
| In vivo | 2% DMSO+corn oil | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.69 mL | 188.46 mL | 376.92 mL |
| 0.5 mM | 7.54 mL | 37.69 mL | 75.38 mL |
| 1 mM | 3.77 mL | 18.85 mL | 37.69 mL |
| 5 mM | 0.75 mL | 3.77 mL | 7.54 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
