Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AR-42 is a novel HDAC inhibitor, exhibits biologic activity against malignant mast cell lines via down-regulation of constitutively activated Kit. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11037 |
|---|---|
| Formula | C18H20N2O3 |
| Molecular Weight | 312.4 |
| CAS Number | 935881-37-1 |
| SMILES | CC(C)[C@@H](C1=CC=CC=C1)C(=O)NC2=CC=C(C=C2)C(=O)NO |
| Synonyms | AR42, OSU-HDAC42 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 62 mg/mL (198.49 mM) | |
| Water | Insoluble | ||
| Ethanol | 62 mg/mL (198.49 mM) | ||
| In vivo | 0.5% methylcellulose+0.2% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.01 mL | 160.05 mL | 320.1 mL |
| 0.5 mM | 6.4 mL | 32.01 mL | 64.02 mL |
| 1 mM | 3.2 mL | 16.01 mL | 32.01 mL |
| 5 mM | 0.64 mL | 3.2 mL | 6.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
