Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZ-960 is a potent, selective and ATP competitive JAK2 inhibitor that inhibits JAK2 kinase with a Ki of 0.45 nM in vitro and induces growth arrest and apoptosis in adult T-cell leukemia (ATL) cell. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10104 |
|---|---|
| Formula | C18H16F2N6 |
| Molecular Weight | 354.4 |
| CAS Number | 905586-69-8 |
| SMILES | CC1=CC(=NN1)NC2=C(C=C(C(=N2)N[C@@H](C)C3=CC=C(C=C3)F)C#N)F |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (197.54 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (8.46 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.22 mL | 141.08 mL | 282.17 mL |
| 0.5 mM | 5.64 mL | 28.22 mL | 56.43 mL |
| 1 mM | 2.82 mL | 14.11 mL | 28.22 mL |
| 5 mM | 0.56 mL | 2.82 mL | 5.64 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
