Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Bexarotene is a highly selective retinoid X receptor (RXR) agonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11094 |
|---|---|
| Formula | C24H28O2 |
| Molecular Weight | 348.5 |
| CAS Number | 153559-49-0 |
| SMILES | CC1=CC2=C(C=C1C(=C)C3=CC=C(C=C3)C(=O)O)C(CCC2(C)C)(C)C |
| Synonyms | LGD 1069, SR 11247, Ro 26-4455, Targretin, LG 100069 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (20.11 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.69 mL | 143.47 mL | 286.94 mL |
| 0.5 mM | 5.74 mL | 28.69 mL | 57.39 mL |
| 1 mM | 2.87 mL | 14.35 mL | 28.69 mL |
| 5 mM | 0.57 mL | 2.87 mL | 5.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
