Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BMS-911543 is an orally available small molecule targeting a subset of Janus-associated kinase (JAK) with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11241 |
|---|---|
| Formula | C23H28N8O |
| Molecular Weight | 432.52 |
| CAS Number | 1271022-90-2 |
| SMILES | CCN1C(=CC2=C3C(=C(N=C21)NC4=NN(C(=C4)C)C)N=CN3C)C(=O)N(C5CC5)C6CC6 |
| Synonyms | BMS911543, BMS 911543 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 36 mg/mL (83.23 mM) | |
| Water | Insoluble | ||
| Ethanol | 22 mg/mL (50.86 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.12 mL | 115.6 mL | 231.2 mL |
| 0.5 mM | 4.62 mL | 23.12 mL | 46.24 mL |
| 1 mM | 2.31 mL | 11.56 mL | 23.12 mL |
| 5 mM | 0.46 mL | 2.31 mL | 4.62 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
