Total item
Cart Subtotal
$0.00 Customer Appreciation Sale.
15% off with promo code "APPRECIATION2023" on check out or purchase order
Biological Activity
Cerdulatinib (PRT-062070) is an oral active, multi-targeted tyrosine kinase inhibitor with IC50 of 12 nM/6 nM/8 nM/0.5 nM and 32 nM for JAK1/JAK2/JAK3/TYK2 and Syk, respectively.
Targets
| Target | Value |
|---|---|
| TYK2 | IC50: 0.5nM |
| MST1 | IC50: 4nM |
| ARK5 | IC50: 4nM |
| MLK1 | IC50: 5nM |
| Fms | IC50: 5nM |
| AMPK | IC50: 6nM |
| JAK2 | IC50: 6nM |
| JAK3 | IC50: 8nM |
| TBK1 | IC50: 10nM |
| MARK1 | IC50: 10nM |
| JAK1 | IC50: 12nM |
| PAR1B-a | IC50: 13nM |
| TSSK | IC50: 14nM |
| MST2 | IC50: 15nM |
| GCK | IC50: 18nM |
| JNK3 | IC50: 18nM |
| RSK2 | IC50: 20nM |
| RSK4 | IC50: 28nM |
| Syk | IC50: 32nM |
| Chk1 | IC50: 42nM |
| FLT4 | IC50: 51nM |
| FLT3 | IC50: 90nM |
| RET | IC50: 105nM |
| ITK | IC50: 194nM |
| In vitro (25°C) | DMSO | Warmed: 42 mg/mL (87.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+corn oil | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.75 mL | 103.73 mL | 207.47 mL |
| 0.5 mM | 4.15 mL | 20.75 mL | 41.49 mL |
| 1 mM | 2.07 mL | 10.37 mL | 20.75 mL |
| 5 mM | 0.41 mL | 2.07 mL | 4.15 mL |
*The above data is based on the productmolecular weight 482. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
| Catalog Num | A14210 |
|---|---|
| Actions | Inhibitor |
| CAS No. | 1369761-01-2 |
| Formula | C20H28ClN7O3S |
| M. Wt | 482 |
| Purity | >98% |
| Synonyms | PRT062070, PRT2070, PRT-2070 |
| SMILES | CCS(=O)(=O)N1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)NC4CC4)C(=O)N.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
Product Tags
Product Questions
Product Questions
No Questions
Keywords:buy Cerdulatinib | Cerdulatinib Supplier | purchase | cost | manufacturer | order | distributor | buy 1369761-01-2| 1369761-01-2 Supplier | purchase 1369761-01-2 | 1369761-01-2 cost | 1369761-01-2 manufacturer | order 1369761-01-2 | 1369761-01-2 distributor
Adooq Quality Guarantee
We promise all products perform as described.