Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cerdulatinib (PRT-062070) is an oral active, multi-targeted tyrosine kinase inhibitor with IC50 of 12 nM/6 nM/8 nM/0.5 nM and 32 nM for JAK1/JAK2/JAK3/TYK2 and Syk, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14210 |
|---|---|
| Formula | C20H28ClN7O3S |
| Molecular Weight | 482 |
| CAS Number | 1369761-01-2 |
| SMILES | CCS(=O)(=O)N1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)NC4CC4)C(=O)N.Cl |
| Synonyms | PRT062070, PRT2070, PRT-2070 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 42 mg/mL (87.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+corn oil | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.75 mL | 103.73 mL | 207.47 mL |
| 0.5 mM | 4.15 mL | 20.75 mL | 41.49 mL |
| 1 mM | 2.07 mL | 10.37 mL | 20.75 mL |
| 5 mM | 0.41 mL | 2.07 mL | 4.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
