Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CHIR-124 is a novel and potent Chk1 inhibitor (IC50: 0.32 nM and 697 nM for Chk1 and Chk2 respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11046 |
|---|---|
| Formula | C23H22ClN5O |
| Molecular Weight | 419.9 |
| CAS Number | 405168-58-3 |
| SMILES | C1CN2CCC1[C@@H](C2)NC3=C4C=C(C=CC4=NC(=O)C3=C5NC6=CC=CC=C6N5)Cl |
| Synonyms | CHIR124 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 6 mg/mL (14.29 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.82 mL | 119.08 mL | 238.15 mL |
| 0.5 mM | 4.76 mL | 23.82 mL | 47.63 mL |
| 1 mM | 2.38 mL | 11.91 mL | 23.82 mL |
| 5 mM | 0.48 mL | 2.38 mL | 4.76 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
