Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CHIR-98014 is a very potent, selective, cell-permeable reversible inhibitor of GSK-3. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11085 |
|---|---|
| Formula | C20H17Cl2N9O2 |
| Molecular Weight | 486.3 |
| CAS Number | 252935-94-7 |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NC(=NC=C2N3C=CN=C3)NCCNC4=NC(=C(C=C4)[N+](=O)[O-])N |
| Synonyms | CHIR98014 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 7 mg/mL (14.39 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+corn oil | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.56 mL | 102.82 mL | 205.63 mL |
| 0.5 mM | 4.11 mL | 20.56 mL | 41.13 mL |
| 1 mM | 2.06 mL | 10.28 mL | 20.56 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
