Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Crassicauline A was extracted from Aconitum sinonapelloides. |
|---|
| Catalog Num | A14615 |
|---|---|
| Formula | C35H49NO10 |
| Molecular Weight | 643.76 |
| CAS Number | 79592-91-9 |
| SMILES | CCN1CC2(CCC(C34C2C(C(C31)C5(CC(C6(CC4C5C6OC(=O)C7=CC=C(C=C7)OC)O)OC)OC(=O)C)OC)OC)COC |
| Synonyms | Crassicaulin A, 3-Deoxyyunaconitine, Crassicauline I |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 99 mg/mL (153.78 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.53 mL | 77.67 mL | 155.34 mL |
| 0.5 mM | 3.11 mL | 15.53 mL | 31.07 mL |
| 1 mM | 1.55 mL | 7.77 mL | 15.53 mL |
| 5 mM | 0.31 mL | 1.55 mL | 3.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
