Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 4-IBP is a selective ς1 agonist with a high level of affinity for the ς1 receptor (Ki = 1.7 nM) and a moderate affinity for the ς2 receptor (Ki = 25.2 nM) . |
|---|
| Catalog Num | A12314 |
|---|---|
| Formula | C19H21IN2O |
| Molecular Weight | 420.29 |
| CAS Number | 155798-08-6 |
| SMILES | O=C(NC1CCN(CC2=CC=CC=C2)CC1)C3=CC=C(I)C=C3 |
| Synonyms | 4IBP, 4 IBP |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 83 mg/mL (197.48 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (11.89 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.79 mL | 118.97 mL | 237.93 mL |
| 0.5 mM | 4.76 mL | 23.79 mL | 47.59 mL |
| 1 mM | 2.38 mL | 11.9 mL | 23.79 mL |
| 5 mM | 0.48 mL | 2.38 mL | 4.76 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
