Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Danicopan (ACH-4471), a selective and orally active small-molecule factor D inhibitor, shows high binding affinity to human Factor D with Kd value of 0.54 nM. |
|---|
| Catalog Num | A18609 |
|---|---|
| Formula | C26H23BrFN7O3 |
| Molecular Weight | 580.41 |
| CAS Number | 1903768-17-1 |
| SMILES | O=C([C@H]1N(C(CN2N=C(C(C)=O)C3=C2C=CC(C4=CN=C(C)N=C4)=C3)=O)C[C@H](F)C1)NC5=NC(Br)=CC=C5 |
| Synonyms | ACH-4471, ACH4471, ACH 4471 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (156.78 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.23 mL | 86.15 mL | 172.29 mL |
| 0.5 mM | 3.45 mL | 17.23 mL | 34.46 mL |
| 1 mM | 1.72 mL | 8.61 mL | 17.23 mL |
| 5 mM | 0.34 mL | 1.72 mL | 3.45 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
