Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Minaprine is a reversible inhibitor of MAO-A; weakly inhibit acetylcholinesterase; an antidepressant for treatment of depression. |
|---|
| Catalog Num | A17722 |
|---|---|
| Formula | C17H24Cl2N4O |
| Molecular Weight | 371.31 |
| CAS Number | 25905-77-5 |
| SMILES | CC1=CC(=NN=C1NCCN2CCOCC2)C3=CC=CC=C3.Cl.Cl |
| Synonyms | Minaprine dihydrochloride, Cantor, Minaprina, Minaprinum, Brantur, Agr 1240 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (177.75 mM) | |
| Water | 66 mg/mL (177.75 mM) | ||
| Ethanol | 4 mg/mL (10.77 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.93 mL | 134.66 mL | 269.32 mL |
| 0.5 mM | 5.39 mL | 26.93 mL | 53.86 mL |
| 1 mM | 2.69 mL | 13.47 mL | 26.93 mL |
| 5 mM | 0.54 mL | 2.69 mL | 5.39 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
