Signaling Pathway
c-Met/VEGFR-2 inhibitor
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | E7050 (also known as golvatinib is an orally bioavailable dual kinase inhibitor of c-Met (hepatocyte growth factor receptor) and VEGFR-2 (vascular endothelial growth factor receptor-2) tyrosine kinases with potential antineoplastic activity. | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A11396 |
|---|---|
| Formula | C33H37F2N7O4 |
| Molecular Weight | 633.69 |
| CAS Number | 928037-13-2 |
| SMILES | CN1CCN(CC1)C2CCN(CC2)C(=O)NC3=NC=CC(=C3)OC4=CC(=C(C=C4)NC(=O)C5(CC5)C(=O)NC6=CC=C(C=C6)F)F |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 18 mg/mL (28.4 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.78 mL | 78.9 mL | 157.81 mL |
| 0.5 mM | 3.16 mL | 15.78 mL | 31.56 mL |
| 1 mM | 1.58 mL | 7.89 mL | 15.78 mL |
| 5 mM | 0.32 mL | 1.58 mL | 3.16 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
