Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fangchinoline is an isolate of Stephania tetrandra that has anticancer activity. |
|---|
| Catalog Num | A14557 |
|---|---|
| Formula | C37H40N2O6 |
| Molecular Weight | 608.72 |
| CAS Number | 33889-68-8 |
| SMILES | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(O3)C(=C(C=C7CCN6C)OC)O)OC)OC |
| Synonyms | Menisidine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (142.91 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (4.93 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.43 mL | 82.14 mL | 164.28 mL |
| 0.5 mM | 3.29 mL | 16.43 mL | 32.86 mL |
| 1 mM | 1.64 mL | 8.21 mL | 16.43 mL |
| 5 mM | 0.33 mL | 1.64 mL | 3.29 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
