Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Febuxostat is a non-purine inhibitor of xanthine oxidase (Ki = 1.2 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10382 |
|---|---|
| Formula | C16H16N2O3S |
| Molecular Weight | 316.4 |
| CAS Number | 144060-53-7 |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)OCC(C)C)C#N)C(=O)O |
| Synonyms | TMX 67 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (189.65 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.61 mL | 158.03 mL | 316.06 mL |
| 0.5 mM | 6.32 mL | 31.61 mL | 63.21 mL |
| 1 mM | 3.16 mL | 15.8 mL | 31.61 mL |
| 5 mM | 0.63 mL | 3.16 mL | 6.32 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
