Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fosaprepitant is a selective neurokinin-1 (NK-1) receptor antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11069 |
|---|---|
| Formula | C37H56F7N6O16P |
| Molecular Weight | 1004.84 |
| CAS Number | 265121-04-8 |
| SMILES | C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@@H](N(CCO2)CC3=NC(=O)N(N3)P(=O)(O)O)C4=CC=C(C=C4)F.CNC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O.CNC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| Synonyms | MK 0517 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 183 mg/mL (182.12 mM) | |
| Water | 123 mg/mL (122.41 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 9.95 mL | 49.76 mL | 99.52 mL |
| 0.5 mM | 1.99 mL | 9.95 mL | 19.9 mL |
| 1 mM | 1 mL | 4.98 mL | 9.95 mL |
| 5 mM | 0.2 mL | 1 mL | 1.99 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
