Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fraxetin is an O-methylated coumarin. It can be found in Fraxinus rhynchophylla. |
|---|
| Catalog Num | A14554 |
|---|---|
| Formula | C10H8O5 |
| Molecular Weight | 208.17 |
| CAS Number | 574-84-5 |
| SMILES | COC1=C(C(=C2C(=C1)C=CC(=O)O2)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 37 mg/mL (177.73 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 48.04 mL | 240.19 mL | 480.38 mL |
| 0.5 mM | 9.61 mL | 48.04 mL | 96.08 mL |
| 1 mM | 4.8 mL | 24.02 mL | 48.04 mL |
| 5 mM | 0.96 mL | 4.8 mL | 9.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
