Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GW501516 (GW1516 or GSK-516) is a drug that acts as a PPARδ modulator. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11437 |
|---|---|
| Formula | C21H18F3NO3S2 |
| Molecular Weight | 453.5 |
| CAS Number | 317318-70-0 |
| SMILES | CC1=C(C=CC(=C1)SCC2=C(N=C(S2)C3=CC=C(C=C3)C(F)(F)F)C)OCC(=O)O |
| Synonyms | GW501516, GW-501516, GW1516, GSK-516, GW-1516, GSK516 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (189.63 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.05 mL | 110.25 mL | 220.51 mL |
| 0.5 mM | 4.41 mL | 22.05 mL | 44.1 mL |
| 1 mM | 2.21 mL | 11.03 mL | 22.05 mL |
| 5 mM | 0.44 mL | 2.21 mL | 4.41 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
