Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | HMN-214 inhibits polo-like and cyclin-dependent kinase activity, has potent antimicrotubular effects and results in profound apoptosis and antitumor activity in a broad spectrum of human xenografts. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10452 |
|---|---|
| Formula | C22H20N2O5S |
| Molecular Weight | 424.5 |
| CAS Number | 173529-46-9 |
| SMILES | CC(=O)N(C1=CC=CC=C1/C=C/C2=CC=[N+](C=C2)[O-])S(=O)(=O)C3=CC=C(C=C3)OC |
| Synonyms | IVX-214 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 11 mg/mL (25.91 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% methylcellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.56 mL | 117.79 mL | 235.57 mL |
| 0.5 mM | 4.71 mL | 23.56 mL | 47.11 mL |
| 1 mM | 2.36 mL | 11.78 mL | 23.56 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
