Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Isocorynoxeine was extracted from Uncaria rhynchophylla (Miq.) Jacks. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14659 |
|---|---|
| Formula | C22H26N2O4 |
| Molecular Weight | 382.45 |
| CAS Number | 51014-29-0 |
| SMILES | CO/C=C(\[C@H]1C[C@H]2[C@]3(CCN2C[C@@H]1C=C)C4=CC=CC=C4NC3=O)/C(=O)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (175.18 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.15 mL | 130.74 mL | 261.47 mL |
| 0.5 mM | 5.23 mL | 26.15 mL | 52.29 mL |
| 1 mM | 2.61 mL | 13.07 mL | 26.15 mL |
| 5 mM | 0.52 mL | 2.61 mL | 5.23 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
