Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Isoprenaline or isoproterenol is a non-selective beta-adrenergic agonist and structurally similar to adrenaline. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10484 |
|---|---|
| Formula | C11H17NO3.HCl |
| Molecular Weight | 247.2 |
| CAS Number | 51-30-9 |
| SMILES | CC(C)NCC(C1=CC(=C(C=C1)O)O)O.Cl |
| Synonyms | Isuprel, Isadrine, Euspiran, Proternol, NSC 37745, NSC 89747 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 46 mg/mL (185.69 mM) | |
| Water | 46 mg/mL (185.69 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.45 mL | 202.27 mL | 404.53 mL |
| 0.5 mM | 8.09 mL | 40.45 mL | 80.91 mL |
| 1 mM | 4.05 mL | 20.23 mL | 40.45 mL |
| 5 mM | 0.81 mL | 4.05 mL | 8.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
