Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ispinesib (SB-715992) is a potent inhibitor of kinesin spindle protein, a kinesin motor protein essential for the formation of a bipolar mitotic spindle and cell cycle progression through mitosis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10486 |
|---|---|
| Formula | C30H33ClN4O2 |
| Molecular Weight | 517.1 |
| CAS Number | 336113-53-2 |
| SMILES | CC1=CC=C(C=C1)C(=O)N(CCCN)[C@@H](C2=NC3=C(C=CC(=C3)Cl)C(=O)N2CC4=CC=CC=C4)C(C)C |
| Synonyms | Ispinesib mesylate,B-715992,CK 0238273 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (179.86 mM) | |
| Water | Insoluble | ||
| Ethanol | 93 mg/mL (179.86 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.34 mL | 96.69 mL | 193.39 mL |
| 0.5 mM | 3.87 mL | 19.34 mL | 38.68 mL |
| 1 mM | 1.93 mL | 9.67 mL | 19.34 mL |
| 5 mM | 0.39 mL | 1.93 mL | 3.87 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
