Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ITF2357 (Givinostat) is a HDACs inhibitor with potential anti-inflammatory, anti-angiogenic, and antineoplastic activities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10488 |
|---|---|
| Formula | C24H27N3O4.HCl.H2O |
| Molecular Weight | 476 |
| CAS Number | 732302-99-7 |
| SMILES | CC[NH+](CC)CC1=CC2=C(C=C1)C=C(C=C2)COC(=O)NC3=CC=C(C=C3)C(=O)NO.O.[Cl-] |
| Synonyms | Gavinostat |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 94 mg/mL (197.49 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL | ||
| In vivo | 5%DMSO+40%PEG300++5%Tween80+50%ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.01 mL | 105.04 mL | 210.08 mL |
| 0.5 mM | 4.2 mL | 21.01 mL | 42.02 mL |
| 1 mM | 2.1 mL | 10.5 mL | 21.01 mL |
| 5 mM | 0.42 mL | 2.1 mL | 4.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
