Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Linifanib (ABT-869) is a structurally novel, potent inhibitor of RTK, VEGF and PDGF with IC50 of 0.2, 2, 4, and 7 nM for human endothelial cells, PDGFR-β, KDR, and CSF-1R, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10025 |
|---|---|
| Formula | C21H18FN5O |
| Molecular Weight | 375.4 |
| CAS Number | 796967-16-3 |
| SMILES | CC1=CC(=C(C=C1)F)NC(=O)NC2=CC=C(C=C2)C3=C4C(=CC=C3)NN=C4N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 73 mg/mL (194.45 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5%DMSO+40%PEG 300+5%Tween80+50%ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.64 mL | 133.19 mL | 266.38 mL |
| 0.5 mM | 5.33 mL | 26.64 mL | 53.28 mL |
| 1 mM | 2.66 mL | 13.32 mL | 26.64 mL |
| 5 mM | 0.53 mL | 2.66 mL | 5.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
