Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | LY2784544 is identified as being highly selective for JAK2-V617F and has advanced into human clinical trials for the treatment of several myeloproliferative disorders. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10546 |
|---|---|
| Formula | C23H25ClFN7O |
| Molecular Weight | 469.9 |
| CAS Number | 1229236-86-5 |
| SMILES | CC1=CC(=NN1)NC2=NN3C(=C(N=C3C(=C2)CN4CCOCC4)C)CC5=C(C=C(C=C5)Cl)F |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (195.76 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (19.15 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.28 mL | 106.41 mL | 212.81 mL |
| 0.5 mM | 4.26 mL | 21.28 mL | 42.56 mL |
| 1 mM | 2.13 mL | 10.64 mL | 21.28 mL |
| 5 mM | 0.43 mL | 2.13 mL | 4.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
