Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY2940680 has been shown to affect a cancer cell signaling pathway initiated by the Hedgehog (Hh) protein. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11048 |
|---|---|
| Formula | C26H24F4N6O |
| Molecular Weight | 512.5 |
| CAS Number | 1258861-20-9 |
| SMILES | CN1C(=CC=N1)C2=NN=C(C3=CC=CC=C32)N4CCC(CC4)N(C)C(=O)C5=C(C=C(C=C5)F)C(F)(F)F |
| Synonyms | LY-2940680 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 4 mg/mL (7.8 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.51 mL | 97.56 mL | 195.12 mL |
| 0.5 mM | 3.9 mL | 19.51 mL | 39.02 mL |
| 1 mM | 1.95 mL | 9.76 mL | 19.51 mL |
| 5 mM | 0.39 mL | 1.95 mL | 3.9 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
