Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | ML171 (2-Acetylphenothiazine;2-APT) is a potent and selective NADPH oxidase 1 (Nox1) inhibitor that blocks Nox1-dependent ROS generation, with an IC50 of 0.25 μM in HEK293-Nox1 confirmatory assay. |
|---|
| Catalog Num | A13360 |
|---|---|
| Formula | C14H11NOS |
| Molecular Weight | 241.31 |
| CAS Number | 6631-94-3 |
| SMILES | CC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2 |
| Synonyms | ML-171, ML171 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (182.33 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.44 mL | 207.2 mL | 414.4 mL |
| 0.5 mM | 8.29 mL | 41.44 mL | 82.88 mL |
| 1 mM | 4.14 mL | 20.72 mL | 41.44 mL |
| 5 mM | 0.83 mL | 4.14 mL | 8.29 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
