Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | MLN 2480 is an oral, selective pan-Raf kinase inhibitor in chinical trials. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11240 |
|---|---|
| Formula | C17H12Cl2F3N7O2S |
| Molecular Weight | 506.29 |
| CAS Number | 1096708-71-2 |
| SMILES | C[C@H](C1=NC=C(S1)C(=O)NC2=NC=C(C(=C2)C(F)(F)F)Cl)NC(=O)C3=C(C(=NC=N3)N)Cl |
| Synonyms | MLN-2480,BIIB 024, BIIB-024 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (187.63 mM) | |
| Water | Insoluble | ||
| Ethanol | 95 mg/mL (187.63 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.75 mL | 98.76 mL | 197.52 mL |
| 0.5 mM | 3.95 mL | 19.75 mL | 39.5 mL |
| 1 mM | 1.98 mL | 9.88 mL | 19.75 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
