Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Motesanib (AMG706) is a multikinase inhibitor that selectively targets VEGF receptors, platelet-derived growth factor receptors (PDGFRs), and Kit receptors with IC?? values of 2 nM (VEGFR1), 3 nM (VEGFR2), 6 nM (VEGFR3), 84 nM (PDGFR), and 8 nM (Kit). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11496 |
|---|---|
| Formula | C22H23N5O |
| Molecular Weight | 373.45 |
| CAS Number | 453562-69-1 |
| SMILES | CC1(CNC2=C1C=CC(=C2)NC(=O)C3=C(N=CC=C3)NCC4=CC=NC=C4)C |
| Synonyms | AMG 706, AMG-706 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (182.09 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL (18.74 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.78 mL | 133.89 mL | 267.77 mL |
| 0.5 mM | 5.36 mL | 26.78 mL | 53.55 mL |
| 1 mM | 2.68 mL | 13.39 mL | 26.78 mL |
| 5 mM | 0.54 mL | 2.68 mL | 5.36 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
