Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | MRS 2578 is a selective antagonist of P2Y6 nucleotide receptors | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11486 |
|---|---|
| Formula | C20H20N6S4 |
| Molecular Weight | 472.7 |
| CAS Number | 711019-86-2 |
| SMILES | C1=CC(=CC(=C1)NC(=S)NCCCCNC(=S)NC2=CC=CC(=C2)N=C=S)N=C=S |
| Synonyms | MRS2578 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 39 mg/mL (82.5 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.16 mL | 105.78 mL | 211.55 mL |
| 0.5 mM | 4.23 mL | 21.16 mL | 42.31 mL |
| 1 mM | 2.12 mL | 10.58 mL | 21.16 mL |
| 5 mM | 0.42 mL | 2.12 mL | 4.23 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
