Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NVP-BEP800 is a novel, fully synthetic, orally bioavailable inhibitor that binds to the NH2-terminal ATP-binding pocket of Hsp90. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10660 |
|---|---|
| Formula | C21H23Cl2N5O2S |
| Molecular Weight | 480.4 |
| CAS Number | 847559-80-2 |
| SMILES | CCNC(=O)C1=CC2=C(N=C(N=C2S1)N)C3=CC(=C(C=C3Cl)Cl)OCCN4CCCC4 |
| Synonyms | VER-82576 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Insoluble | |
| Water | Insoluble | ||
| Ethanol | 13 mg/mL (27.06 mM) | ||
| In vivo | 0.5% methylcellulose | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.82 mL | 104.08 mL | 208.16 mL |
| 0.5 mM | 4.16 mL | 20.82 mL | 41.63 mL |
| 1 mM | 2.08 mL | 10.41 mL | 20.82 mL |
| 5 mM | 0.42 mL | 2.08 mL | 4.16 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
