Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NVP-BVU972 is a selective MET inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11150 |
|---|---|
| Formula | C20H16N6 |
| Molecular Weight | 340.4 |
| CAS Number | 1185763-69-2 |
| SMILES | CN1C=C(C=N1)C2=NN3C(=NC=C3CC4=CC5=C(C=C4)N=CC=C5)C=C2 |
| Synonyms | NVPBVU972 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (196.83 mM) | |
| Water | Insoluble | ||
| Ethanol | 67 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.38 mL | 146.89 mL | 293.77 mL |
| 0.5 mM | 5.88 mL | 29.38 mL | 58.75 mL |
| 1 mM | 2.94 mL | 14.69 mL | 29.38 mL |
| 5 mM | 0.59 mL | 2.94 mL | 5.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
